CAS 618-74-6 appears in our catalog under these names: 3,4,5-Tribromobenzoic acid, 95%, 3,4,5-Tribromobenzoic acid, 3,4,5-Tribromobenzoic acid - technical grade. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 0,25kg, 50mg, 0,1kg, 25mg.
3,4,5-tribromobenzoic acid (CAS 618-74-6) is a chemical compound with the molecular formula C7H3Br3O2 and a molecular weight of 358.81 g/mol. IUPAC name: 3,4,5-tribromobenzoic acid. InChIKey: UDZOUVAHFWHQEL-UHFFFAOYSA-N.
| Molecular formula | C7H3Br3O2 |
|---|---|
| Molecular weight | 358.81 g/mol |
| IUPAC name | 3,4,5-tribromobenzoic acid |
| InChIKey | UDZOUVAHFWHQEL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)Br)Br)C(=O)O |
Computed by PubChem (NCBI)