cas: 5995-86-8 — see every product listed under this CAS number, including other names
3,4,5-Trihydroxybenzoic acid hydrate, 98%, 98% (CAS 5995-86-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 500g, 1mg, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QQ2-25g |
| cas | 5995-86-8 |
| size | 25g |
| availability | 7000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 93.20 Pln | |
| Chemat | 100g | 93.20 Pln | |
| Chemat | 200g | 126.80 Pln | |
| Chemat | 300g | 155.60 Pln | |
| Chemat | 500g | 240.00 Pln | |
| Chemat | 1mg | 78.80 Pln | |
| Chemat | 1kg | 395.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,4,5-trihydroxybenzoic acid;hydrate (CAS 5995-86-8) is a chemical compound with the molecular formula C7H8O6 and a molecular weight of 188.13 g/mol. IUPAC name: 3,4,5-trihydroxybenzoic acid;hydrate. InChIKey: IUTKPPDDLYYMBE-UHFFFAOYSA-N.
| Molecular formula | C7H8O6 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 3,4,5-trihydroxybenzoic acid;hydrate |
| InChIKey | IUTKPPDDLYYMBE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)O.O |
Computed by PubChem (NCBI)