cas: 1228180-83-3 — see every product listed under this CAS number, including other names
3,4-DibroMophenylboronic acid, 98%, 98% (CAS 1228180-83-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110WUJ-100mg |
| cas | 1228180-83-3 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 640.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3,4-dibromophenyl)boronic acid (CAS 1228180-83-3) is a chemical compound with the molecular formula C6H5BBr2O2 and a molecular weight of 279.72 g/mol. IUPAC name: (3,4-dibromophenyl)boronic acid. InChIKey: XKIRCGHFBJLPPW-UHFFFAOYSA-N.
| Molecular formula | C6H5BBr2O2 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | (3,4-dibromophenyl)boronic acid |
| InChIKey | XKIRCGHFBJLPPW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Br)Br)(O)O |
Computed by PubChem (NCBI)