cas: 1706458-07-2 — see every product listed under this CAS number, including other names
3,4-Dichloro-5-(trifluoromethyl)benzoyl chloride, 98% (CAS 1706458-07-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1237744-1g |
| cas | 1706458-07-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 10310.23 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,4-dichloro-5-(trifluoromethyl)benzoyl chloride (CAS 1706458-07-2) is a chemical compound with the molecular formula C8H2Cl3F3O and a molecular weight of 277.4 g/mol. IUPAC name: 3,4-dichloro-5-(trifluoromethyl)benzoyl chloride. InChIKey: AIAWYNKIJWQIOE-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl3F3O |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | 3,4-dichloro-5-(trifluoromethyl)benzoyl chloride |
| InChIKey | AIAWYNKIJWQIOE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)Cl)C(=O)Cl |
Computed by PubChem (NCBI)