cas: 1451391-08-4 — see every product listed under this CAS number, including other names
3,4-Dichloropyridine-5-boronic acid pinacol ester, 98% (CAS 1451391-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627914-100MG |
| cas | 1451391-08-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 721.64 Pln | |
| Fluorochem | 250mg | 1112.13 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,4-dichloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1451391-08-4) is a chemical compound with the molecular formula C11H14BCl2NO2 and a molecular weight of 274.0 g/mol. IUPAC name: 3,4-dichloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: YPRJPTVHFRCJEL-UHFFFAOYSA-N.
| Molecular formula | C11H14BCl2NO2 |
|---|---|
| Molecular weight | 274.0 g/mol |
| IUPAC name | 3,4-dichloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | YPRJPTVHFRCJEL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CC(=C2Cl)Cl |
Computed by PubChem (NCBI)