3,5,6-Trichloropyridine-2,4-diamine, 95%
cas: 725208-26-4 — see every product listed under this CAS number, including other names
3,5,6-Trichloropyridine-2,4-diamine, 95% (CAS 725208-26-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A419688-250mg |
| cas | 725208-26-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 921.06 Pln | |
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 1g | 1499.60 Pln | |
| Fluorochem | 100mg | 679.99 Pln | |
| Fluorochem | 250mg | 1101.71 Pln | |
| Fluorochem | 1g | 2788.62 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 986.34 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3,5,6-trichloropyridine-2,4-diamine (CAS 725208-26-4) is a chemical compound with the molecular formula C5H4Cl3N3 and a molecular weight of 212.46 g/mol. IUPAC name: 3,5,6-trichloropyridine-2,4-diamine. InChIKey: FGIUJKXQIISHOO-UHFFFAOYSA-N.
| Molecular formula | C5H4Cl3N3 |
|---|---|
| Molecular weight | 212.46 g/mol |
| IUPAC name | 3,5,6-trichloropyridine-2,4-diamine |
| InChIKey | FGIUJKXQIISHOO-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)Cl)N)Cl)N |
Computed by PubChem (NCBI)