cas: 26107-82-4 — see every product listed under this CAS number, including other names
3,5-Bis(trifluoromethyl)benzoic acid hydrazide, 97% (CAS 26107-82-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006010-1G |
| cas | 26107-82-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 10g | 320.74 Pln | |
| Fluorochem | 25g | 502.97 Pln | |
| Fluorochem | 100g | 1846.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
3,5-bis(trifluoromethyl)benzohydrazide (CAS 26107-82-4) is a chemical compound with the molecular formula C9H6F6N2O and a molecular weight of 272.15 g/mol. IUPAC name: 3,5-bis(trifluoromethyl)benzohydrazide. InChIKey: GBBRFBSFWKFTMZ-UHFFFAOYSA-N.
| Molecular formula | C9H6F6N2O |
|---|---|
| Molecular weight | 272.15 g/mol |
| IUPAC name | 3,5-bis(trifluoromethyl)benzohydrazide |
| InChIKey | GBBRFBSFWKFTMZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)NN |
Computed by PubChem (NCBI)