cas: 886-35-1 — see every product listed under this CAS number, including other names
3,5-Bis(trifluoromethyl)phenylhydrazine (CAS 886-35-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IKB-250mg |
| cas | 886-35-1 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 314.00 Pln | |
| Chemat | 25g | 1115.60 Pln |
| delivery time | 3 weeks |
|---|
[3,5-bis(trifluoromethyl)phenyl]hydrazine (CAS 886-35-1) is a chemical compound with the molecular formula C8H6F6N2 and a molecular weight of 244.14 g/mol. IUPAC name: [3,5-bis(trifluoromethyl)phenyl]hydrazine. InChIKey: OULWACKZBGBRNT-UHFFFAOYSA-N.
| Molecular formula | C8H6F6N2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | [3,5-bis(trifluoromethyl)phenyl]hydrazine |
| InChIKey | OULWACKZBGBRNT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)NN)C(F)(F)F |
Computed by PubChem (NCBI)