cas: 1257641-28-3 — see every product listed under this CAS number, including other names
3,5-DICHLORO-4-PYRIDINEBORONIC ACID PINACOL ESTER, 97% (CAS 1257641-28-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F533020-1G |
| cas | 1257641-28-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 331.15 Pln | |
| Fluorochem | 5g | 1440.14 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3,5-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1257641-28-3) is a chemical compound with the molecular formula C11H14BCl2NO2 and a molecular weight of 274.0 g/mol. IUPAC name: 3,5-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: RGVJCGWAHPEENO-UHFFFAOYSA-N.
| Molecular formula | C11H14BCl2NO2 |
|---|---|
| Molecular weight | 274.0 g/mol |
| IUPAC name | 3,5-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | RGVJCGWAHPEENO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2Cl)Cl |
Computed by PubChem (NCBI)