cas: 2246602-45-7 — see every product listed under this CAS number, including other names
3,5-DIMETHYL-1-(TETRAHYDRO-2H-PYRAN-4-YL)-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-PYRAZOLE, 95% (CAS 2246602-45-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F513221-100MG |
| cas | 2246602-45-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 633.13 Pln | |
| Fluorochem | 1g | 1950.37 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dimethyl-1-(oxan-4-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2246602-45-7) is a chemical compound with the molecular formula C16H27BN2O3 and a molecular weight of 306.2 g/mol. IUPAC name: 3,5-dimethyl-1-(oxan-4-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: STYSUGRCCRUROI-UHFFFAOYSA-N.
| Molecular formula | C16H27BN2O3 |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | 3,5-dimethyl-1-(oxan-4-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | STYSUGRCCRUROI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N(N=C2C)C3CCOCC3)C |
Computed by PubChem (NCBI)