cas: 17360-11-1 — see every product listed under this CAS number, including other names
3,5-DINITRO-L-TYROSINE, 98% (CAS 17360-11-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F799316-1G |
| cas | 17360-11-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 659.16 Pln | |
| Fluorochem | 10g | 914.28 Pln | |
| Fluorochem | 25g | 1565.09 Pln | |
| Fluorochem | 50g | 2377.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3,5-dinitro-L-tyrosine is a non-proteinogenic L-alpha-amino acid that is L-tyrosine substituted by nitro groups at positions 3 and 5. It is a L-tyrosine derivative, a C-nitro compound and a non-proteinogenic L-alpha-amino acid.
Source: ChEBI
| Molecular formula | C9H9N3O7 |
|---|---|
| Molecular weight | 271.18 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxy-3,5-dinitrophenyl)propanoic acid |
| InChIKey | SAZOSDSFLRXREA-YFKPBYRVSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)[N+](=O)[O-])C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)