cas: 4330-21-6 — see every product listed under this CAS number, including other names
3,5-Di-O-toluoyl-α-1-chloro-2-deoxy-D-ribofuranose, 90%, 90% (CAS 4330-21-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DE40-250mg |
| cas | 4330-21-6 |
| size | 250mg |
| availability | 609.35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 246.80 Pln | |
| Chemat | 100g | 722.00 Pln | |
| Chemat | 500g | 3302.40 Pln | |
| Chemat | 50g | 419.60 Pln | |
| Chemat | 250g | 1682.00 Pln |
| purity | 90% |
|---|---|
| delivery time | 3 weeks |
[(2R,3S,5R)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (CAS 4330-21-6) is a chemical compound with the molecular formula C21H21ClO5 and a molecular weight of 388.8 g/mol. IUPAC name: [(2R,3S,5R)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate. InChIKey: FJHSYOMVMMNQJQ-OTWHNJEPSA-N.
| Molecular formula | C21H21ClO5 |
|---|---|
| Molecular weight | 388.8 g/mol |
| IUPAC name | [(2R,3S,5R)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| InChIKey | FJHSYOMVMMNQJQ-OTWHNJEPSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H](C[C@H](O2)Cl)OC(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)