cas: 1242329-23-2 — see every product listed under this CAS number, including other names
3,5-Dibromo-4-chloropyridin-2-amine, 98% (CAS 1242329-23-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F617318-1G |
| cas | 1242329-23-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 591.48 Pln | |
| Fluorochem | 10g | 1122.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dibromo-4-chloropyridin-2-amine (CAS 1242329-23-2) is a chemical compound with the molecular formula C5H3Br2ClN2 and a molecular weight of 286.35 g/mol. IUPAC name: 3,5-dibromo-4-chloropyridin-2-amine. InChIKey: LGSFOPKQUAVZJX-UHFFFAOYSA-N.
| Molecular formula | C5H3Br2ClN2 |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | 3,5-dibromo-4-chloropyridin-2-amine |
| InChIKey | LGSFOPKQUAVZJX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)N)Br)Cl)Br |
Computed by PubChem (NCBI)