3,5-Dibromo-4-methoxypyridine 1-oxide, 98%
cas: 650140-84-4 — see every product listed under this CAS number, including other names
3,5-Dibromo-4-methoxypyridine 1-oxide, 98% (CAS 650140-84-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F601063-100MG |
| cas | 650140-84-4 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 1080.89 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 270.25 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 236.61 Pln | |
| BLDpharm | 5g | 269.93 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
3,5-dibromo-4-methoxy-1-oxidopyridin-1-ium (CAS 650140-84-4) is a chemical compound with the molecular formula C6H5Br2NO2 and a molecular weight of 282.92 g/mol. IUPAC name: 3,5-dibromo-4-methoxy-1-oxidopyridin-1-ium. InChIKey: KAYQEYHOGFRTAL-UHFFFAOYSA-N.
| Molecular formula | C6H5Br2NO2 |
|---|---|
| Molecular weight | 282.92 g/mol |
| IUPAC name | 3,5-dibromo-4-methoxy-1-oxidopyridin-1-ium |
| InChIKey | KAYQEYHOGFRTAL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=[N+](C=C1Br)[O-])Br |
Computed by PubChem (NCBI)