cas: 104599-36-2 — see every product listed under this CAS number, including other names
3,5-Dibromo-4-nitro-1H-pyrazole 95% (CAS 104599-36-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A164062-250mg |
| cas | 104599-36-2 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 359.25 Pln | |
| Ambeed | 25g | 770.88 Pln | |
| Ambeed | 100g | 2873.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A164062 |
3,5-dibromo-4-nitro-1H-pyrazole (CAS 104599-36-2) is a chemical compound with the molecular formula C3HBr2N3O2 and a molecular weight of 270.87 g/mol. IUPAC name: 3,5-dibromo-4-nitro-1H-pyrazole. InChIKey: HUEFSFAVCVCTAX-UHFFFAOYSA-N.
| Molecular formula | C3HBr2N3O2 |
|---|---|
| Molecular weight | 270.87 g/mol |
| IUPAC name | 3,5-dibromo-4-nitro-1H-pyrazole |
| InChIKey | HUEFSFAVCVCTAX-UHFFFAOYSA-N |
| SMILES | C1(=C(NN=C1Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)