CAS 942132-66-3 appears in our catalog under these names: 3,5–Dibromo–5'–phenyl–1,1':3',1''–terphenyl, 3,5-Dibromo-5'-phenyl-1,1':3',1''-terphenyl, 95%, 3,5-Dibromo-5'-phenyl-1,1':3',1''-terphenyl, >98.0%(GC), 3,5-Dibromo-5'-phenyl-1,1':3',1''-terphenyl, 98.0%, 98.0%, 3,5-Dibromo-5'-phenyl-1,1':3',1''-terphenyl, 97%. Offered by: GLPBio, Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 200mg.
1,3-dibromo-5-(3,5-diphenylphenyl)benzene (CAS 942132-66-3) is a chemical compound with the molecular formula C24H16Br2 and a molecular weight of 464.2 g/mol. IUPAC name: 1,3-dibromo-5-(3,5-diphenylphenyl)benzene. InChIKey: ZZMHOZGMSDLDMS-UHFFFAOYSA-N.
| Molecular formula | C24H16Br2 |
|---|---|
| Molecular weight | 464.2 g/mol |
| IUPAC name | 1,3-dibromo-5-(3,5-diphenylphenyl)benzene |
| InChIKey | ZZMHOZGMSDLDMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)C3=CC(=CC(=C3)Br)Br)C4=CC=CC=C4 |
Computed by PubChem (NCBI)