CAS 117695-55-3 appears in our catalog under these names: 3,5–Dibromophenylboronic acid(contains varying amounts of Anhydride), 3,5-Dibromobenzeneboronic acid, 97% , 3,5-Dibromophenylboronic acid, 3,5-Dibromophenylboronic Acid (contains varying amounts of Anhydride), 3,5-DIBROMOPHENYLBORONIC ACID, >=95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 50g, 1g, 10g, 500g.
(3,5-dibromophenyl)boronic acid (CAS 117695-55-3) is a chemical compound with the molecular formula C6H5BBr2O2 and a molecular weight of 279.72 g/mol. IUPAC name: (3,5-dibromophenyl)boronic acid. InChIKey: WQBLCGDZYFKINX-UHFFFAOYSA-N.
| Molecular formula | C6H5BBr2O2 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | (3,5-dibromophenyl)boronic acid |
| InChIKey | WQBLCGDZYFKINX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)Br)(O)O |
Computed by PubChem (NCBI)