cas: 1126779-11-0 — see every product listed under this CAS number, including other names
3,5-Dimethyl-1-(tetrahydro-2H-pyran-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole 95% (CAS 1126779-11-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193029-250mg |
| cas | 1126779-11-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 1388.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A193029 |
3,5-dimethyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1126779-11-0) is a chemical compound with the molecular formula C16H27BN2O3 and a molecular weight of 306.2 g/mol. IUPAC name: 3,5-dimethyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: ZNDYJQBCSOGOJQ-UHFFFAOYSA-N.
| Molecular formula | C16H27BN2O3 |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | 3,5-dimethyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | ZNDYJQBCSOGOJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N(N=C2C)C3CCCCO3)C |
Computed by PubChem (NCBI)