3,6,9,12,15,18,21,24,27,30,33,36-Dodecaoxaoctatriacontane-1,38-diol, 98%, 98%
cas: 17598-96-8 — see every product listed under this CAS number, including other names
3,6,9,12,15,18,21,24,27,30,33,36-Dodecaoxaoctatriacontane-1,38-diol, 98%, 98% (CAS 17598-96-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1132C4-100mg |
| cas | 17598-96-8 |
| size | 100mg |
| availability | 250g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 923.60 Pln | |
| Chemat | 25g | 2128.40 Pln | |
| Chemat | 50g | 3923.60 Pln | |
| Chemat | 100g | 5219.60 Pln | |
| Chemat | 250g | 10389.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (CAS 17598-96-8) is a chemical compound with the molecular formula C26H54O14 and a molecular weight of 590.7 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: AKWFJQNBHYVIPY-UHFFFAOYSA-N.
| Molecular formula | C26H54O14 |
|---|---|
| Molecular weight | 590.7 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | AKWFJQNBHYVIPY-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)O |
Computed by PubChem (NCBI)