3,6,9,12,15,18,21,24,27,30,33-Undecaoxapentatriacontanedioic acid, 95%
cas: 1391054-54-8 — see every product listed under this CAS number, including other names
3,6,9,12,15,18,21,24,27,30,33-Undecaoxapentatriacontanedioic acid, 95% (CAS 1391054-54-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A642475-50mg |
| cas | 1391054-54-8 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 615.13 Pln | |
| Ambeed | 100mg | 943.31 Pln | |
| Ambeed | 250mg | 1627.50 Pln | |
| Ambeed | 1g | 4425.44 Pln | |
| BLDpharm | 50mg | 658.68 Pln | |
| BLDpharm | 100mg | 1014.11 Pln | |
| BLDpharm | 250mg | 1747.19 Pln | |
| BLDpharm | 1g | 4768.35 Pln | |
| Chemat | 50mg | 448.40 Pln | |
| Chemat | 100mg | 683.60 Pln | |
| Chemat | 250mg | 1168.40 Pln | |
| Chemat | 1g | 3165.20 Pln | |
| Fluorochem | 100mg | 966.34 Pln | |
| Fluorochem | 250mg | 1669.22 Pln | |
| Fluorochem | 1g | 4527.59 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 1391054-54-8) is a chemical compound with the molecular formula C24H46O15 and a molecular weight of 574.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: PQQMGDVYNQSLIF-UHFFFAOYSA-N.
| Molecular formula | C24H46O15 |
|---|---|
| Molecular weight | 574.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | PQQMGDVYNQSLIF-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCC(=O)O)OCCOCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)