cas: 908258-58-2 — see every product listed under this CAS number, including other names
3,6,9,12,15,18,21,24,27,30,33-Undecaoxatetratriacontanoic acid, 98% (CAS 908258-58-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863795-100MG |
| cas | 908258-58-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 758.08 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 908258-58-2) is a chemical compound with the molecular formula C23H46O13 and a molecular weight of 530.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: DNJQYLLQMMESPG-UHFFFAOYSA-N.
| Molecular formula | C23H46O13 |
|---|---|
| Molecular weight | 530.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | DNJQYLLQMMESPG-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)