cas: 82209-36-7 — see every product listed under this CAS number, including other names
3,6,9,12,15,18,21,24-Octaoxahexacosane-1,26-diamine, 98% (CAS 82209-36-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863935-100MG |
| cas | 82209-36-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 500mg | 565.44 Pln | |
| Fluorochem | 1g | 1028.82 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 82209-36-7) is a chemical compound with the molecular formula C18H40N2O8 and a molecular weight of 412.5 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: QNNWDQWXZAXENQ-UHFFFAOYSA-N.
| Molecular formula | C18H40N2O8 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | QNNWDQWXZAXENQ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCN)N |
Computed by PubChem (NCBI)