cas: 77855-75-5 — see every product listed under this CAS number, including other names
3,6,9,12,15-PENTAOXAHEPTADECANEDIOIC ACID, 98%, 98% (CAS 77855-75-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119O9B-100mg |
| cas | 77855-75-5 |
| size | 100mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 500mg | 165.20 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 957.20 Pln | |
| Chemat | 10g | 1672.40 Pln | |
| Chemat | 25g | 3506.00 Pln | |
| Chemat | 50g | 5853.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 77855-75-5) is a chemical compound with the molecular formula C12H22O9 and a molecular weight of 310.30 g/mol. IUPAC name: 2-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: WIVPWKOWHCVJKT-UHFFFAOYSA-N.
| Molecular formula | C12H22O9 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | WIVPWKOWHCVJKT-UHFFFAOYSA-N |
| SMILES | C(COCCOCC(=O)O)OCCOCCOCC(=O)O |
Computed by PubChem (NCBI)