cas: 5662-81-7 — see every product listed under this CAS number, including other names
3,6,9,16,19,22-Hexaoxa-12,13-dithiatetracosane-1,24-diol, 95%, 95% (CAS 5662-81-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IA4Q-100mg |
| cas | 5662-81-7 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 803.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyldisulfanyl]ethoxy]ethoxy]ethoxy]ethanol (CAS 5662-81-7) is a chemical compound with the molecular formula C16H34O8S2 and a molecular weight of 418.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyldisulfanyl]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: LSCOQDOWFVSGMZ-UHFFFAOYSA-N.
| Molecular formula | C16H34O8S2 |
|---|---|
| Molecular weight | 418.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyldisulfanyl]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | LSCOQDOWFVSGMZ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCSSCCOCCOCCOCCO)O |
Computed by PubChem (NCBI)