3,6-Dibromo-4-fluorobenzene-1,2-diamine, 98%
cas: 1347736-83-7 — see every product listed under this CAS number, including other names
3,6-Dibromo-4-fluorobenzene-1,2-diamine, 98% (CAS 1347736-83-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1328724-250mg |
| cas | 1347736-83-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1099.06 Pln | |
| Ambeed | 5g | 3151.62 Pln | |
| Ambeed | 10g | 4686.88 Pln | |
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| BLDpharm | 100mg | 392.11 Pln | |
| BLDpharm | 250mg | 525.40 Pln | |
| BLDpharm | 1g | 1175.17 Pln | |
| BLDpharm | 5g | 3391.05 Pln | |
| BLDpharm | 10g | 5051.58 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3,6-dibromo-4-fluorobenzene-1,2-diamine (CAS 1347736-83-7) is a chemical compound with the molecular formula C6H5Br2FN2 and a molecular weight of 283.92 g/mol. IUPAC name: 3,6-dibromo-4-fluorobenzene-1,2-diamine. InChIKey: BHFHVALJBJOMHY-UHFFFAOYSA-N.
| Molecular formula | C6H5Br2FN2 |
|---|---|
| Molecular weight | 283.92 g/mol |
| IUPAC name | 3,6-dibromo-4-fluorobenzene-1,2-diamine |
| InChIKey | BHFHVALJBJOMHY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)N)N)Br)F |
Computed by PubChem (NCBI)