cas: 173063-52-0 — see every product listed under this CAS number, including other names
3,6-Dibromo-9-(2-ethylhexyl)-9H-carbazole, 98% (CAS 173063-52-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A706805-250mg |
| cas | 173063-52-0 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1366.06 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 1072.40 Pln | |
| BLDpharm | 100mg | 203.29 Pln | |
| BLDpharm | 250mg | 258.82 Pln | |
| BLDpharm | 1g | 469.86 Pln | |
| BLDpharm | 5g | 1469.51 Pln | |
| Fluorochem | 100mg | 305.12 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 664.37 Pln | |
| Fluorochem | 5g | 1981.61 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3,6-dibromo-9-(2-ethylhexyl)carbazole (CAS 173063-52-0) is a chemical compound with the molecular formula C20H23Br2N and a molecular weight of 437.2 g/mol. IUPAC name: 3,6-dibromo-9-(2-ethylhexyl)carbazole. InChIKey: ZDFZWZGIGKUBRA-UHFFFAOYSA-N.
| Molecular formula | C20H23Br2N |
|---|---|
| Molecular weight | 437.2 g/mol |
| IUPAC name | 3,6-dibromo-9-(2-ethylhexyl)carbazole |
| InChIKey | ZDFZWZGIGKUBRA-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CN1C2=C(C=C(C=C2)Br)C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)