3,6-Dibromo-9-octyl-9H-carbazole, 98%
cas: 79554-93-1 — see every product listed under this CAS number, including other names
3,6-Dibromo-9-octyl-9H-carbazole, 98% (CAS 79554-93-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A571442-100mg |
| cas | 79554-93-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 943.31 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1000.40 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 386.56 Pln | |
| BLDpharm | 5g | 1014.11 Pln | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 5g | 966.34 Pln | |
| Fluorochem | 10g | 1861.86 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
3,6-dibromo-9-octylcarbazole (CAS 79554-93-1) is a chemical compound with the molecular formula C20H23Br2N and a molecular weight of 437.2 g/mol. IUPAC name: 3,6-dibromo-9-octylcarbazole. InChIKey: MFYGWCVLNPQWRR-UHFFFAOYSA-N.
| Molecular formula | C20H23Br2N |
|---|---|
| Molecular weight | 437.2 g/mol |
| IUPAC name | 3,6-dibromo-9-octylcarbazole |
| InChIKey | MFYGWCVLNPQWRR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN1C2=C(C=C(C=C2)Br)C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)