3,6-Dibromo-9-phenyl-9H-carbazole, 98%
cas: 57103-20-5 — see every product listed under this CAS number, including other names
3,6-Dibromo-9-phenyl-9H-carbazole, 98% (CAS 57103-20-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F791162-25G |
| cas | 57103-20-5 |
| size | 25g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 258.26 Pln | |
| Fluorochem | 100g | 497.76 Pln | |
| Fluorochem | 500g | 2215.90 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 259.12 Pln | |
| Ambeed | 100g | 548.38 Pln | |
| Ambeed | 500g | 2445.19 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 414.80 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3,6-dibromo-9-phenylcarbazole (CAS 57103-20-5) is a chemical compound with the molecular formula C18H11Br2N and a molecular weight of 401.1 g/mol. IUPAC name: 3,6-dibromo-9-phenylcarbazole. InChIKey: JBWRZTKHMKVFMQ-UHFFFAOYSA-N.
| Molecular formula | C18H11Br2N |
|---|---|
| Molecular weight | 401.1 g/mol |
| IUPAC name | 3,6-dibromo-9-phenylcarbazole |
| InChIKey | JBWRZTKHMKVFMQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)Br)C4=C2C=CC(=C4)Br |
Computed by PubChem (NCBI)