cas: 1204812-01-0 — see every product listed under this CAS number, including other names
3,8-Dibromoquinolin-4-ol, 99%, 99% (CAS 1204812-01-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11045P-100mg |
| cas | 1204812-01-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 827.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
3,8-dibromo-1H-quinolin-4-one (CAS 1204812-01-0) is a chemical compound with the molecular formula C9H5Br2NO and a molecular weight of 302.95 g/mol. IUPAC name: 3,8-dibromo-1H-quinolin-4-one. InChIKey: GEOSMWHTWPLBPB-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO |
|---|---|
| Molecular weight | 302.95 g/mol |
| IUPAC name | 3,8-dibromo-1H-quinolin-4-one |
| InChIKey | GEOSMWHTWPLBPB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC=C(C2=O)Br |
Computed by PubChem (NCBI)