cas: 3058-04-6 — see every product listed under this CAS number, including other names
3,9-Bis(2-cyanoethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane, ≥98%, ≥98% (CAS 3058-04-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IR6-1g |
| cas | 3058-04-6 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 25g | 290.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
3-[3-(2-cyanoethyl)-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]propanenitrile (CAS 3058-04-6) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: 3-[3-(2-cyanoethyl)-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]propanenitrile. InChIKey: BNAMIPLIODPZLE-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 3-[3-(2-cyanoethyl)-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]propanenitrile |
| InChIKey | BNAMIPLIODPZLE-UHFFFAOYSA-N |
| SMILES | C1C2(COC(O1)CCC#N)COC(OC2)CCC#N |
Computed by PubChem (NCBI)