cas: 508-02-1 — see every product listed under this CAS number, including other names
3β-Hydroxyolean-12-en-28-oic acid, 98%, 98% (CAS 508-02-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I04Y-1g |
| cas | 508-02-1 |
| size | 1g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 50g | 146.00 Pln | |
| Chemat | 100g | 213.20 Pln | |
| Chemat | 250g | 390.80 Pln | |
| Chemat | 500g | 681.60 Pln | |
| Chemat | 1kg | 1216.40 Pln | |
| Chemat | 5kg | 5635.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Oleanolic acid is a pentacyclic triterpenoid that is olean-12-en-28-oic acid substituted by a beta-hydroxy group at position 3. It has a role as a plant metabolite. It is a pentacyclic triterpenoid and a hydroxy monocarboxylic acid. It is a conjugate acid of an oleanolate. It derives from a hydride of an oleanane.
Source: ChEBI
| Molecular formula | C30H48O3 |
|---|---|
| Molecular weight | 456.7 g/mol |
| IUPAC name | (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| InChIKey | MIJYXULNPSFWEK-GTOFXWBISA-N |
| SMILES | C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C(=O)O)C)C)(C)C)O |
Computed by PubChem (NCBI)