cas: 79476-36-1 — see every product listed under this CAS number, including other names
3,3'-(1H-Pyrazole-3,5-diyl)dipyridine, 95%, 95% (CAS 79476-36-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNQZ-100mg |
| cas | 79476-36-1 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(3-pyridin-3-yl-1H-pyrazol-5-yl)pyridine (CAS 79476-36-1) is a chemical compound with the molecular formula C13H10N4 and a molecular weight of 222.24 g/mol. IUPAC name: 3-(3-pyridin-3-yl-1H-pyrazol-5-yl)pyridine. InChIKey: YVTBIPNIMMAQLZ-UHFFFAOYSA-N.
| Molecular formula | C13H10N4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-(3-pyridin-3-yl-1H-pyrazol-5-yl)pyridine |
| InChIKey | YVTBIPNIMMAQLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC(=NN2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)