cas: 2246685-26-5 — see every product listed under this CAS number, including other names
3,3-dimethyl-N-(4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)butanamide, 97%, 97% (CAS 2246685-26-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FU8S-100mg |
| cas | 2246685-26-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 746.00 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,3-dimethyl-N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanamide (CAS 2246685-26-5) is a chemical compound with the molecular formula C19H30BNO3 and a molecular weight of 331.3 g/mol. IUPAC name: 3,3-dimethyl-N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanamide. InChIKey: NQJVACHFHANTJI-UHFFFAOYSA-N.
| Molecular formula | C19H30BNO3 |
|---|---|
| Molecular weight | 331.3 g/mol |
| IUPAC name | 3,3-dimethyl-N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanamide |
| InChIKey | NQJVACHFHANTJI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)NC(=O)CC(C)(C)C)C |
Computed by PubChem (NCBI)