cas: 187960-74-3 — see every product listed under this CAS number, including other names
3,5-Bis[2-(boc-amino)ethoxy]-benzoic acid, 95+%, 95+% (CAS 187960-74-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113GL6-100mg |
| cas | 187960-74-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 539.60 Pln | |
| Chemat | 1g | 1672.40 Pln | |
| Chemat | 250mg | 866.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
3,5-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid (CAS 187960-74-3) is a chemical compound with the molecular formula C21H32N2O8 and a molecular weight of 440.5 g/mol. IUPAC name: 3,5-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid. InChIKey: HOQVHRMJXLYZNT-UHFFFAOYSA-N.
| Molecular formula | C21H32N2O8 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | 3,5-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid |
| InChIKey | HOQVHRMJXLYZNT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOC1=CC(=CC(=C1)C(=O)O)OCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)