cas: 264263-98-1 — see every product listed under this CAS number, including other names
3,7-dibromo-10-(2-ethylhexyl)-10H-phenothiazine, 95%, 95% (CAS 264263-98-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113T6Z-250mg |
| cas | 264263-98-1 |
| size | 250mg |
| availability | 6.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,7-dibromo-10-(2-ethylhexyl)phenothiazine (CAS 264263-98-1) is a chemical compound with the molecular formula C20H23Br2NS and a molecular weight of 469.3 g/mol. IUPAC name: 3,7-dibromo-10-(2-ethylhexyl)phenothiazine. InChIKey: BKMNQLRBGNJKPI-UHFFFAOYSA-N.
| Molecular formula | C20H23Br2NS |
|---|---|
| Molecular weight | 469.3 g/mol |
| IUPAC name | 3,7-dibromo-10-(2-ethylhexyl)phenothiazine |
| InChIKey | BKMNQLRBGNJKPI-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CN1C2=C(C=C(C=C2)Br)SC3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)