cas: 696611-46-8 — see every product listed under this CAS number, including other names
3,8-Dibromo-6-nitroquinoline, 96%, 96% (CAS 696611-46-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBYO-100mg |
| cas | 696611-46-8 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 1g | 1322.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3,8-dibromo-6-nitroquinoline (CAS 696611-46-8) is a chemical compound with the molecular formula C9H4Br2N2O2 and a molecular weight of 331.95 g/mol. IUPAC name: 3,8-dibromo-6-nitroquinoline. InChIKey: IPAXEFNOGMMLJV-UHFFFAOYSA-N.
| Molecular formula | C9H4Br2N2O2 |
|---|---|
| Molecular weight | 331.95 g/mol |
| IUPAC name | 3,8-dibromo-6-nitroquinoline |
| InChIKey | IPAXEFNOGMMLJV-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C=NC2=C(C=C1[N+](=O)[O-])Br)Br |
Computed by PubChem (NCBI)