3-(((4-Fluorophenyl)thio)methyl)piperidine hydrochloride, 98%, 98%
cas: 1289385-78-9 — see every product listed under this CAS number, including other names
3-(((4-Fluorophenyl)thio)methyl)piperidine hydrochloride, 98%, 98% (CAS 1289385-78-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111YLC-100mg |
| cas | 1289385-78-9 |
| size | 100mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 707.60 Pln | |
| Chemat | 1g | 1662.80 Pln | |
| Chemat | 5g | 6266.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[(4-fluorophenyl)sulfanylmethyl]piperidine;hydrochloride (CAS 1289385-78-9) is a chemical compound with the molecular formula C12H17ClFNS and a molecular weight of 261.79 g/mol. IUPAC name: 3-[(4-fluorophenyl)sulfanylmethyl]piperidine;hydrochloride. InChIKey: KOLDOKJVNIYCNZ-UHFFFAOYSA-N.
| Molecular formula | C12H17ClFNS |
|---|---|
| Molecular weight | 261.79 g/mol |
| IUPAC name | 3-[(4-fluorophenyl)sulfanylmethyl]piperidine;hydrochloride |
| InChIKey | KOLDOKJVNIYCNZ-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)CSC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-(((4-Fluorophenyl)thio)methyl)piperidine hydrochloride, 3-(4-Fluoro-phenylsulfanylmethyl)-piperidine hydrochloride, 3-[(4-fluorophenyl)sulfanylmethyl]piperidine;hydrochloride, 3-{[(4-fluorophenyl)sulfanyl]methyl}piperidine hydrochloride, 4-fluoro-1-(3-piperidylmethylthio)benzene, chloride, 3-(((4-Fluorophenyl)thio)methyl)piperidinehydrochloride