cas: 127971-54-4 — see every product listed under this CAS number, including other names
3-((3,4-dimethyl-2,6-dinitrophenyl)amino)pentan-2-ol, 95%, 95% (CAS 127971-54-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DV7H-100mg |
| cas | 127971-54-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1029.20 Pln | |
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 1g | 4197.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(3,4-dimethyl-2,6-dinitroanilino)pentan-2-ol (CAS 127971-54-4) is a chemical compound with the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. IUPAC name: 3-(3,4-dimethyl-2,6-dinitroanilino)pentan-2-ol. InChIKey: RDXISYZKTOBPEZ-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O5 |
|---|---|
| Molecular weight | 297.31 g/mol |
| IUPAC name | 3-(3,4-dimethyl-2,6-dinitroanilino)pentan-2-ol |
| InChIKey | RDXISYZKTOBPEZ-UHFFFAOYSA-N |
| SMILES | CCC(C(C)O)NC1=C(C=C(C(=C1[N+](=O)[O-])C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)