cas: 110598-30-6 — see every product listed under this CAS number, including other names
3-((Trimethylsilyl)ethynyl)aniline, 98%, 98% (CAS 110598-30-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118USH-100mg |
| cas | 110598-30-6 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 443.60 Pln | |
| Chemat | 5g | 1250.00 Pln | |
| Chemat | 10g | 2190.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(2-trimethylsilylethynyl)aniline (CAS 110598-30-6) is a chemical compound with the molecular formula C11H15NSi and a molecular weight of 189.33 g/mol. IUPAC name: 3-(2-trimethylsilylethynyl)aniline. InChIKey: UMDLPUJBLHKTSG-UHFFFAOYSA-N.
| Molecular formula | C11H15NSi |
|---|---|
| Molecular weight | 189.33 g/mol |
| IUPAC name | 3-(2-trimethylsilylethynyl)aniline |
| InChIKey | UMDLPUJBLHKTSG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC(=CC=C1)N |
Computed by PubChem (NCBI)