cas: 96013-95-5 — see every product listed under this CAS number, including other names
3-((tert-Butyldimethylsilyl)oxy)benzaldehyde, 97%, 97% (CAS 96013-95-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12H6QL-100mg |
| cas | 96013-95-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1000.40 Pln | |
| Chemat | 5g | 4720.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[tert-butyl(dimethyl)silyl]oxybenzaldehyde (CAS 96013-95-5) is a chemical compound with the molecular formula C13H20O2Si and a molecular weight of 236.38 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxybenzaldehyde. InChIKey: AAEJMRFPMLLTIX-UHFFFAOYSA-N.
| Molecular formula | C13H20O2Si |
|---|---|
| Molecular weight | 236.38 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxybenzaldehyde |
| InChIKey | AAEJMRFPMLLTIX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=CC(=C1)C=O |
Computed by PubChem (NCBI)