cas: 929913-18-8 — see every product listed under this CAS number, including other names
3-((tert-Butyldimethylsilyl)oxy)cyclobutanone, 98%, 98% (CAS 929913-18-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHF9-100mg |
| cas | 929913-18-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 602.00 Pln | |
| Chemat | 500mg | 1082.00 Pln | |
| Chemat | 1g | 1134.80 Pln | |
| Chemat | 5g | 3520.40 Pln | |
| Chemat | 25g | 16960.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[tert-butyl(dimethyl)silyl]oxycyclobutan-1-one (CAS 929913-18-8) is a chemical compound with the molecular formula C10H20O2Si and a molecular weight of 200.35 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxycyclobutan-1-one. InChIKey: WMGWIMAOHZAWOT-UHFFFAOYSA-N.
| Molecular formula | C10H20O2Si |
|---|---|
| Molecular weight | 200.35 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxycyclobutan-1-one |
| InChIKey | WMGWIMAOHZAWOT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(=O)C1 |
Computed by PubChem (NCBI)