cas: 62605-69-0 — see every product listed under this CAS number, including other names
3-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-1-propanesulfonyl chloride (CAS 62605-69-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F512009-1G |
| cas | 62605-69-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2439.78 Pln |
| delivery time | 3-4 weeks |
|---|
3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonyl chloride (CAS 62605-69-0) is a chemical compound with the molecular formula C11H10ClNO4S and a molecular weight of 287.72 g/mol. IUPAC name: 3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonyl chloride. InChIKey: RDXUBBUYWZAROQ-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO4S |
|---|---|
| Molecular weight | 287.72 g/mol |
| IUPAC name | 3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonyl chloride |
| InChIKey | RDXUBBUYWZAROQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCS(=O)(=O)Cl |
Computed by PubChem (NCBI)