cas: 112677-67-5 — see every product listed under this CAS number, including other names
3-(1H-Imidazol-1-yl)aniline, 98%, 98% (CAS 112677-67-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1180CV-100mg |
| cas | 112677-67-5 |
| size | 100mg |
| availability | 12g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 909.20 Pln | |
| Chemat | 10g | 1758.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-imidazol-1-ylaniline (CAS 112677-67-5) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: 3-imidazol-1-ylaniline. InChIKey: JVKJLZRWXBUBFN-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | 3-imidazol-1-ylaniline |
| InChIKey | JVKJLZRWXBUBFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=CN=C2)N |
Computed by PubChem (NCBI)