cas: 1170691-45-8 — see every product listed under this CAS number, including other names
3-(1H-Pyrazol-4-yl)aniline, 97% (CAS 1170691-45-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695604-250MG |
| cas | 1170691-45-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 500mg | 372.80 Pln | |
| Fluorochem | 1g | 685.19 Pln | |
| Fluorochem | 2.5g | 1622.36 Pln | |
| Fluorochem | 5g | 3184.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(1H-pyrazol-4-yl)aniline (CAS 1170691-45-8) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: 3-(1H-pyrazol-4-yl)aniline. InChIKey: MSVASNFGSQCRCN-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | 3-(1H-pyrazol-4-yl)aniline |
| InChIKey | MSVASNFGSQCRCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CNN=C2 |
Computed by PubChem (NCBI)