3-(2,4-Di-tert-butylphenoxy)pyrrolidine hydrochloride, 95%
cas: 1220017-79-7 — see every product listed under this CAS number, including other names
3-(2,4-Di-tert-butylphenoxy)pyrrolidine hydrochloride, 95% (CAS 1220017-79-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A757608-250mg |
| cas | 1220017-79-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 604.00 Pln | |
| Ambeed | 1g | 1505.12 Pln | |
| BLDpharm | 100mg | 386.56 Pln | |
| BLDpharm | 250mg | 597.59 Pln | |
| BLDpharm | 1g | 1480.61 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 1g | 1149.20 Pln | |
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 622.72 Pln | |
| Fluorochem | 1g | 1554.68 Pln | |
| Fluorochem | 5g | 2778.21 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-(2,4-ditert-butylphenoxy)pyrrolidine;hydrochloride (CAS 1220017-79-7) is a chemical compound with the molecular formula C18H30ClNO and a molecular weight of 311.9 g/mol. IUPAC name: 3-(2,4-ditert-butylphenoxy)pyrrolidine;hydrochloride. InChIKey: GEYASWZHWOQZIA-UHFFFAOYSA-N.
| Molecular formula | C18H30ClNO |
|---|---|
| Molecular weight | 311.9 g/mol |
| IUPAC name | 3-(2,4-ditert-butylphenoxy)pyrrolidine;hydrochloride |
| InChIKey | GEYASWZHWOQZIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC2CCNC2)C(C)(C)C.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-(2,4-di-tert-butylphenoxy)pyrrolidine hydrochloride, 3-[2,4-Di(tert-butyl)phenoxy]pyrrolidine hydrochloride, 3-[2,4-Di(tert-butyl)phenoxy]pyrrolidinehydrochloride, 3-(2,4-ditert-butylphenoxy)pyrrolidine;hydrochloride, C18H30ClNO, 3-(2,4-ditert-butylphenoxy)pyrrolidine, 3-(2,4-di-tert-butylphenoxy)pyrrolidinehydrochloride