3-(2,6-Bis(benzyloxy)pyridin-3-yl)-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 95%
cas: 2655652-42-7 — see every product listed under this CAS number, including other names
3-(2,6-Bis(benzyloxy)pyridin-3-yl)-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 95% (CAS 2655652-42-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A14403495-100mg |
| cas | 2655652-42-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 553.94 Pln | |
| Ambeed | 1g | 1366.06 Pln | |
| Ambeed | 5g | 3719.00 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 586.48 Pln | |
| BLDpharm | 1g | 1469.51 Pln | |
| BLDpharm | 5g | 4007.50 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1010.00 Pln | |
| Chemat | 5g | 2747.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 2655652-42-7) is a chemical compound with the molecular formula C33H34BN3O4 and a molecular weight of 547.5 g/mol. IUPAC name: 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: SXONPFCTIRSJJI-UHFFFAOYSA-N.
| Molecular formula | C33H34BN3O4 |
|---|---|
| Molecular weight | 547.5 g/mol |
| IUPAC name | 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | SXONPFCTIRSJJI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C(=NN3C)C4=C(N=C(C=C4)OCC5=CC=CC=C5)OCC6=CC=CC=C6 |
Computed by PubChem (NCBI)