3-(2-(2-(2-((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)oxy)acetamido)ethoxy)ethoxy)propanoic acid, 95%
cas: 2700243-67-8 — see every product listed under this CAS number, including other names
3-(2-(2-(2-((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)oxy)acetamido)ethoxy)ethoxy)propanoic acid, 95% (CAS 2700243-67-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1504735-250mg |
| cas | 2700243-67-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2517.50 Pln | |
| Ambeed | 1g | 7913.12 Pln | |
| BLDpharm | 50mg | 647.57 Pln | |
| BLDpharm | 100mg | 1119.63 Pln | |
| BLDpharm | 250mg | 2474.71 Pln | |
| BLDpharm | 1g | 7756.18 Pln | |
| Chemat | 50mg | 520.40 Pln | |
| Chemat | 100mg | 870.80 Pln | |
| Chemat | 250mg | 1912.40 Pln | |
| Chemat | 1g | 6198.80 Pln | |
| Fluorochem | 100mg | 1174.60 Pln | |
| Fluorochem | 250mg | 2590.77 Pln | |
| Fluorochem | 1g | 7943.05 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-[2-[2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]ethoxy]ethoxy]propanoic acid (CAS 2700243-67-8) is a chemical compound with the molecular formula C22H25N3O10 and a molecular weight of 491.4 g/mol. IUPAC name: 3-[2-[2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]ethoxy]ethoxy]propanoic acid. InChIKey: FEZXVYUXHZOQAD-UHFFFAOYSA-N.
| Molecular formula | C22H25N3O10 |
|---|---|
| Molecular weight | 491.4 g/mol |
| IUPAC name | 3-[2-[2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]ethoxy]ethoxy]propanoic acid |
| InChIKey | FEZXVYUXHZOQAD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCC(=O)NCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)