cas: 868944-77-8 — see every product listed under this CAS number, including other names
3-(2-Fluorophenyl)isonicotinonitrile, 98% (CAS 868944-77-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F777385-100MG |
| cas | 868944-77-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1216.26 Pln | |
| Fluorochem | 250mg | 1788.97 Pln | |
| Fluorochem | 1g | 2923.99 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(2-fluorophenyl)pyridine-4-carbonitrile (CAS 868944-77-8) is a chemical compound with the molecular formula C12H7FN2 and a molecular weight of 198.20 g/mol. IUPAC name: 3-(2-fluorophenyl)pyridine-4-carbonitrile. InChIKey: XOFNFANGRPSNFB-UHFFFAOYSA-N.
| Molecular formula | C12H7FN2 |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 3-(2-fluorophenyl)pyridine-4-carbonitrile |
| InChIKey | XOFNFANGRPSNFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C=CN=C2)C#N)F |
Computed by PubChem (NCBI)