cas: 158387-19-0 — see every product listed under this CAS number, including other names
3-(2-Iodophenyl)-3-oxopropanenitrile, 96%, 96% (CAS 158387-19-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112Q6G-250mg |
| cas | 158387-19-0 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 1g | 1720.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-(2-iodophenyl)-3-oxopropanenitrile (CAS 158387-19-0) is a chemical compound with the molecular formula C9H6INO and a molecular weight of 271.05 g/mol. IUPAC name: 3-(2-iodophenyl)-3-oxopropanenitrile. InChIKey: PFKFSGXOWIECNG-UHFFFAOYSA-N.
| Molecular formula | C9H6INO |
|---|---|
| Molecular weight | 271.05 g/mol |
| IUPAC name | 3-(2-iodophenyl)-3-oxopropanenitrile |
| InChIKey | PFKFSGXOWIECNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CC#N)I |
Computed by PubChem (NCBI)