cas: 23996-12-5 — see every product listed under this CAS number, including other names
3-(2-Phenyl-1H-imidazol-1-yl)propanenitrile (CAS 23996-12-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114I2C-1g |
| cas | 23996-12-5 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 25g | 400.40 Pln |
| delivery time | 3 weeks |
|---|
3-(2-phenylimidazol-1-yl)propanenitrile (CAS 23996-12-5) is a chemical compound with the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. IUPAC name: 3-(2-phenylimidazol-1-yl)propanenitrile. InChIKey: BVYPJEBKDLFIDL-UHFFFAOYSA-N.
| Molecular formula | C12H11N3 |
|---|---|
| Molecular weight | 197.24 g/mol |
| IUPAC name | 3-(2-phenylimidazol-1-yl)propanenitrile |
| InChIKey | BVYPJEBKDLFIDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=CN2CCC#N |
Computed by PubChem (NCBI)